logo
Home  > Fmoc-Ile-Cl

AE09670

103321-51-3 | Fmoc-Ile-Cl

Packsize Purity Availability Price Discounted Price    Quantity
250mg 95% in stock $24.00 $17.00 -   +
1g 95% in stock $52.00 $37.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AE09670
Chemical Name: Fmoc-Ile-Cl
CAS Number: 103321-51-3
Molecular Formula: C21H22ClNO3
Molecular Weight: 371.8573
MDL Number: MFCD00235816
SMILES: CC[C@@H]([C@@H](C(=O)Cl)NC(=O)OCC1c2ccccc2-c2c1cccc2)C

 

Upstream Synthesis Route
  • Fmoc-Ile-Cl, also known as Fmoc-protected isoleucine chloride, is a key reagent commonly utilized in chemical synthesis. Isoleucine is an essential amino acid that plays a crucial role in protein synthesis and various biological processes. The Fmoc (9-fluorenylmethoxycarbonyl) group serves as a protective moiety, allowing for selective deprotection and coupling reactions in peptide synthesis.In chemical synthesis, Fmoc-Ile-Cl is frequently employed in the solid-phase peptide synthesis (SPPS) process to incorporate isoleucine into peptide chains. This reagent facilitates the stepwise assembly of peptides by reacting with the amino group of the preceding amino acid residue, enabling the controlled elongation of the peptide chain. The Fmoc protection strategy ensures the selective modification of the desired amino acids, leading to the formation of complex peptide structures with high purity and yield.Furthermore, Fmoc-Ile-Cl offers excellent compatibility with other Fmoc-protected amino acids, allowing for the design and synthesis of diverse peptide sequences with specific biological activities. Its versatility and efficiency make it a valuable tool in the field of chemical synthesis for producing custom peptides for research purposes, drug development, and bioconjugation applications.Overall, Fmoc-Ile-Cl plays a vital role in enhancing the precision and efficiency of peptide synthesis, empowering researchers to explore the vast potential of peptides in various scientific and pharmaceutical endeavors.
FEATURED PRODUCTS