AE09662
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 2 weeks | $202.00 | $142.00 | - + | ||
5g | 2 weeks | $328.00 | $230.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE09662 |
Chemical Name: | FMOC-L-LEUCYL CHLORIDE |
CAS Number: | 103321-59-1 |
Molecular Formula: | C21H22ClNO3 |
Molecular Weight: | 371.8573 |
MDL Number: | MFCD00235818 |
SMILES: | CC(C[C@@H](C(=O)Cl)NC(=O)OCC1c2ccccc2-c2c1cccc2)C |
Fmoc-Leu-Cl is a valuable compound widely used in chemical synthesis as a building block for peptide synthesis. This derivative is specifically used for the selective protection of the amino group during solid-phase peptide synthesis. With its Fmoc (9-fluorenylmethoxycarbonyl) protecting group, Fmoc-Leu-Cl can be easily incorporated into peptides and subsequently deprotected under mild conditions to reveal the free amine group for further coupling reactions. This compound allows for precise control over the synthesis of peptides and facilitates the production of complex peptide structures. Additionally, the chloroacetyl moiety in Fmoc-Leu-Cl enables efficient and selective amino group protection, making it an essential tool in peptide chemistry research and drug development.