AD70015
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 98% | in stock | $44.00 | $31.00 | - + | |
500mg | 98% | in stock | $60.00 | $42.00 | - + | |
1g | 98% | in stock | $100.00 | $70.00 | - + | |
5g | 98% | in stock | $400.00 | $280.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD70015 |
Chemical Name: | 2-tert-Butyl-5-nitroaniline |
CAS Number: | 103392-84-3 |
Molecular Formula: | C10H14N2O2 |
Molecular Weight: | 194.2304 |
MDL Number: | MFCD01463870 |
SMILES: | Nc1cc(ccc1C(C)(C)C)[N+](=O)[O-] |
2-(tert-Butyl)-5-nitroaniline is a versatile compound commonly used in chemical synthesis due to its unique properties and reactivity. In organic chemistry, this compound serves as a valuable building block for the production of various advanced materials and pharmaceuticals. Its distinct molecular structure, characterized by a tert-butyl group and a nitro group attached to an aniline backbone, allows for selective functionalization and manipulation in synthetic processes.One prominent application of 2-(tert-Butyl)-5-nitroaniline in chemical synthesis is as a precursor for the synthesis of aromatic compounds and dyes. By leveraging the reactivity of the nitro group, chemists can perform reduction reactions to convert the nitro group to an amino group, enabling further derivatization and incorporation into more complex molecular structures. This compound's tert-butyl group also plays a crucial role in controlling the steric and electronic properties of the resulting products, influencing their chemical and physical characteristics.Moreover, 2-(tert-Butyl)-5-nitroaniline finds utility in the development of novel pharmaceuticals and agrochemicals. The presence of both electron-donating and electron-withdrawing functional groups in its structure makes it a valuable intermediate for designing bioactive molecules with specific target interactions. Through strategic modifications and derivatization, researchers can explore the pharmacological potential of this compound by synthesizing drug candidates with enhanced potency and selectivity.Overall, the strategic position of functional groups in 2-(tert-Butyl)-5-nitroaniline offers chemists a flexible platform for constructing diverse chemical structures with tailored properties for various applications in organic synthesis. By harnessing its synthetic versatility and reactivity, scientists can unlock innovative pathways for creating advanced materials and bioactive compounds with profound implications in the fields of chemistry and medicine.