AD70000
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 95% | in stock | $12.00 | $8.00 | - + | |
10mg | 95% | in stock | $15.00 | $10.00 | - + | |
25mg | 95% | in stock | $19.00 | $13.00 | - + | |
50mg | 95% | in stock | $31.00 | $22.00 | - + | |
100mg | 95% | in stock | $46.00 | $32.00 | - + | |
250mg | 95% | in stock | $97.00 | $68.00 | - + | |
1g | 95% | in stock | $177.00 | $124.00 | - + | |
5g | 95% | in stock | $579.00 | $405.00 | - + | |
10g | 95% | in stock | $1,038.00 | $727.00 | - + | |
25g | 95% | in stock | $2,002.00 | $1,402.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD70000 |
Chemical Name: | (2R)-2-Hydroxypentanedioic acid |
CAS Number: | 103404-90-6 |
Molecular Formula: | C5H8NaO5 |
Molecular Weight: | 171.10379 |
MDL Number: | MFCD00069573 |
SMILES: | OC(=O)CC[C@H](C(=O)O)O.[Na] |
Complexity: | 130 |
Covalently-Bonded Unit Count: | 3 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 2 |
Pentanedioic acid, 2-hydroxy-, sodium salt (1:2), (2R)- is a valuable chemical compound widely used in chemical synthesis processes. This compound plays a crucial role as a versatile intermediate in the production of various pharmaceuticals, agrochemicals, and specialty chemicals. With its unique chemical properties, this sodium salt is particularly useful in organic reactions for building more complex molecules. Its ability to act as a chiral building block also makes it essential in the synthesis of enantiomerically pure compounds. In addition, this compound can serve as a key component in the development of new materials and catalysts, highlighting its significance in advancing modern chemical research and development.