AX11608
Availability | ||
---|---|---|
Typically In Stock |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AX11608 |
Chemical Name: | (S)-METHYL 2-((S)-2-AMINO-3-METHYLBUTANAMIDO)-3-PHENYLPROPANOATE HYDROCHLORIDE |
CAS Number: | 10342-47-9 |
Molecular Formula: | C15H23ClN2O3 |
Molecular Weight: | 314.8077 |
MDL Number: | MFCD31803157 |
SMILES: | COC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](C(C)C)N.Cl |
L-Phenylalanine, L-valyl-, methyl ester, hydrochloride (1:1) is a versatile compound frequently utilized in chemical synthesis due to its unique properties and reactivity. This compound serves as a crucial building block in the creation of various pharmaceuticals, peptides, and complex organic molecules. In chemical synthesis, it acts as a key intermediate in the construction of peptide chains through condensation reactions, enabling the formation of specific amino acid sequences. Additionally, L-Phenylalanine, L-valyl-, methyl ester, hydrochloride (1:1) is instrumental in the development of new drug candidates and bioactive compounds through its ability to undergo selective transformations and functional group manipulations. Its strategic placement within synthetic pathways enhances the efficiency and precision of chemical reactions, leading to the production of high-purity compounds with distinct pharmacological or industrial applications.