AX64512
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 95% | in stock | $46.00 | $32.00 | - + | |
5mg | 95% | in stock | $113.00 | $79.00 | - + | |
10mg | 95% | in stock | $141.00 | $99.00 | - + | |
100mg | 95% | in stock | $789.00 | $552.00 | - + | |
250mg | 95% | in stock | $1,539.00 | $1,077.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AX64512 |
Chemical Name: | GSK2018682 |
CAS Number: | 1034688-30-6 |
Molecular Formula: | C22H21ClN4O4 |
Molecular Weight: | 440.8795 |
MDL Number: | MFCD18633078 |
SMILES: | OC(=O)CCCn1ccc2c1cccc2c1noc(n1)c1cnc(c(c1)Cl)OC(C)C |
GSK 2018682 is a versatile chemical compound commonly utilized in organic synthesis as a key building block for creating complex molecular structures. Its unique molecular properties make it an essential component in various chemical reactions, allowing for the efficient and selective formation of specific bonds. In the realm of chemical synthesis, GSK 2018682 serves as a crucial reagent for the creation of diverse pharmaceutical intermediates, agrochemicals, and functional materials. Its wide-ranging application in the synthesis of organic compounds highlights its significant role in advancing scientific research and innovation across various industries.