logo
Home  > 3-Iodo-4-(trifluoromethyl)benzoic acid

AE28193

1034690-61-3 | 3-Iodo-4-(trifluoromethyl)benzoic acid

Packsize Purity Availability Price Discounted Price    Quantity
1g 98% in stock $24.00 $17.00 -   +
5g 98% in stock $119.00 $84.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AE28193
Chemical Name: 3-Iodo-4-(trifluoromethyl)benzoic acid
CAS Number: 1034690-61-3
Molecular Formula: C8H4F3IO2
Molecular Weight: 316.0158
MDL Number: MFCD18398157
SMILES: OC(=O)c1ccc(c(c1)I)C(F)(F)F

 

Upstream Synthesis Route
  • 3-Iodo-4-(trifluoromethyl)benzoic acid is a versatile and valuable compound in chemical synthesis. It is commonly used as a building block in the synthesis of various pharmaceuticals, agrochemicals, and advanced materials. This compound serves as a key intermediate in the preparation of complex organic molecules due to its unique structural features, including the iodo and trifluoromethyl groups that can be further functionalized.In chemical synthesis, 3-Iodo-4-(trifluoromethyl)benzoic acid is often utilized as a precursor for introducing specific functional groups or moieties into the target molecules. The iodo group, for instance, can be easily modified or substituted with other functional groups through various chemical reactions, such as nucleophilic substitution or metal-catalyzed coupling reactions. This allows for the fine-tuning of the molecular properties and functionalities of the final products.Furthermore, the trifluoromethyl group in 3-Iodo-4-(trifluoromethyl)benzoic acid provides enhanced lipophilicity and electronic properties to the synthesized compounds, making them potentially useful in drug discovery and materials science. By strategically incorporating this fluorinated moiety into the molecular structure, chemists can enhance the pharmacokinetic profile or physical properties of the target molecules, leading to improved efficacy or performance.Overall, the strategic application of 3-Iodo-4-(trifluoromethyl)benzoic acid in chemical synthesis enables chemists to access a diverse array of functionalized compounds with tailored properties for various applications in the fields of pharmaceuticals, agrochemicals, and materials science.
FEATURED PRODUCTS