AI06038
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $43.00 | $30.00 | - + | |
250mg | 95% | in stock | $64.00 | $45.00 | - + | |
1g | 95% | in stock | $155.00 | $108.00 | - + | |
5g | 95% | in stock | $462.00 | $324.00 | - + | |
25g | 95% | in stock | $1,878.00 | $1,315.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI06038 |
Chemical Name: | 4-(4-Chlorophenoxy)phenylboronic acid |
CAS Number: | 1035491-05-4 |
Molecular Formula: | C12H10BClO3 |
Molecular Weight: | 248.47 |
MDL Number: | MFCD13182407 |
SMILES: | Clc1ccc(cc1)Oc1ccc(cc1)B(O)O |
[4-(4-chlorophenoxy)phenyl]boronic acid is a versatile compound commonly used in chemical synthesis due to its unique properties and reactivity. This compound serves as a key building block in the creation of various pharmaceuticals, agrochemicals, and advanced materials. In organic chemistry, it is often employed as a boronic acid derivative for Suzuki-Miyaura cross-coupling reactions, a powerful tool for forming carbon-carbon bonds.By serving as a boronic acid source, [4-(4-chlorophenoxy)phenyl]boronic acid enables the introduction of the phenyl group into complex molecules with high selectivity and efficiency. Its ability to participate in metal-catalyzed coupling reactions makes it a valuable reagent for the synthesis of biaryl compounds, which are essential structural motifs found in many biologically active molecules.Moreover, the chlorophenyl substituent provides additional synthetic versatility, allowing for further modification and functionalization of the molecule. This versatility opens up a wide range of possibilities for creating diverse chemical compounds with tailored properties and functionalities.Overall, [4-(4-chlorophenoxy)phenyl]boronic acid plays a crucial role in modern organic synthesis, offering chemists a powerful tool for constructing complex molecules and facilitating the development of new chemical entities for various applications.