AD80330
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 98% | in stock | $16.00 | $11.00 | - + | |
250mg | 98% | in stock | $28.00 | $20.00 | - + | |
1g | 98% | in stock | $57.00 | $40.00 | - + | |
2500mg | 98% | in stock | $98.00 | $69.00 | - + | |
5g | 98% | in stock | $167.00 | $117.00 | - + | |
10g | 98% | in stock | $327.00 | $229.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD80330 |
Chemical Name: | 8-Bromoxanthine |
CAS Number: | 10357-68-3 |
Molecular Formula: | C5HBrN4O2 |
Molecular Weight: | 228.991 |
MDL Number: | MFCD02683597 |
SMILES: | O=C1N=C2N=C(N=C2C(=O)N1)Br |
8-Bromo-1H-purine-2,6(3H,7H)-dione, a versatile compound used in chemical synthesis, serves as a crucial building block for the creation of novel pharmaceuticals, agrochemicals, and materials. Its unique molecular structure and reactive properties make it a valuable intermediate in the preparation of various functionalized derivatives. This compound is particularly employed in the development of purine-based molecules, which are essential components in the synthesis of nucleic acids, pharmaceuticals, and biologically active compounds. Through strategic transformations and functional group manipulations, researchers can harness the potential of 8-Bromo-1H-purine-2,6(3H,7H)-dione to access diverse chemical structures with potential applications in drug discovery and material science.