AB63288
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $73.00 | $51.00 | - + | |
5g | 98% | in stock | $201.00 | $141.00 | - + | |
10g | 98% | in stock | $339.00 | $237.00 | - + | |
25g | 98% | in stock | $665.00 | $466.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB63288 |
Chemical Name: | 3-(4-Nitrophenyl)-5-propyl-1,2,4-oxadiazole |
CAS Number: | 10364-67-7 |
Molecular Formula: | C11H11N3O3 |
Molecular Weight: | 233.2233 |
MDL Number: | MFCD09972144 |
SMILES: | CCCc1onc(n1)c1ccc(cc1)[N+](=O)[O-] |
Complexity: | 261 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 5 |
Rotatable Bond Count: | 3 |
XLogP3: | 2.8 |
3-(4-Nitrophenyl)-5-propyl-1,2,4-oxadiazole is a versatile compound widely used in chemical synthesis. Due to its unique structural properties, this compound plays a crucial role in the development of various pharmaceuticals and agrochemicals. Its functional groups allow for facile modification, making it an essential building block in the synthesis of complex organic molecules. Additionally, its stability and reactivity make it an ideal precursor for the preparation of novel materials with tailored properties. This compound is particularly valuable in the development of biologically active compounds and advanced materials due to its broad applicability and potential for diverse chemical transformations.