AD69525
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 95% | 2 weeks | $284.00 | $199.00 | - + | |
5mg | 95% | 2 weeks | $303.00 | $212.00 | - + | |
10mg | 95% | 2 weeks | $338.00 | $237.00 | - + | |
500mg | 95% | 2 weeks | $654.00 | $458.00 | - + | |
1g | 95% | 2 weeks | $893.00 | $625.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD69525 |
Chemical Name: | 4-[5-(4-METHOXYPHENYL)-1H-PYRAZOL-3-YL]PIPERIDINE |
CAS Number: | 103660-47-5 |
Molecular Formula: | C15H19N3O |
Molecular Weight: | 257.3309 |
MDL Number: | MFCD00665098 |
SMILES: | COc1ccc(cc1)c1[nH]nc(c1)C1CCNCC1 |
4-(5-(4-Methoxyphenyl)-1H-pyrazol-3-yl)piperidine is a versatile compound widely used in chemical synthesis as a key building block for the creation of novel pharmaceuticals, agrochemicals, and materials. This molecule plays a crucial role in medicinal chemistry, particularly in the development of new drugs targeting various diseases and disorders. Its unique structure containing both a pyrazole and piperidine ring allows for the synthesis of diverse compounds with potential biological activities. Additionally, 4-(5-(4-Methoxyphenyl)-1H-pyrazol-3-yl)piperidine is utilized in the preparation of complex organic molecules through efficient and selective chemical reactions. Its presence in the synthesis pathway enables the formation of structurally diverse compounds with tailored properties, making it an essential component in the design and production of advanced chemical entities.