AI06126
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 95% | in stock | $103.00 | $72.00 | - + | |
5g | 95% | in stock | $448.00 | $314.00 | - + | |
25g | 95% | in stock | $1,317.00 | $922.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI06126 |
Chemical Name: | Sulfadimethoxine sodium salt |
CAS Number: | 1037-50-9 |
Molecular Formula: | C12H13N4NaO4S |
Molecular Weight: | 332.31079 |
MDL Number: | MFCD00070155 |
SMILES: | COc1nc(OC)nc(c1)[N-]S(=O)(=O)c1ccc(cc1)N.[Na+] |
The Sodium ((4-aminophenyl)sulfonyl)(2,6-dimethoxypyrimidin-4-yl)amide is a versatile compound that finds utility in the realm of chemical synthesis. This compound serves as a key reagent in organic chemistry, particularly in the formation of complex molecular structures. Employed as a building block, it facilitates the synthesis of various biologically active compounds, pharmaceuticals, and agrochemicals. Additionally, this compound is instrumental in the development of novel materials with tailored properties. Its selective reactivity and compatibility with a wide range of functional groups make it a valuable tool for synthetic chemists in designing and constructing intricate molecular architectures. With its strategic placement within a chemical synthesis pathway, Sodium ((4-aminophenyl)sulfonyl)(2,6-dimethoxypyrimidin-4-yl)amide enables the efficient and precise assembly of target molecules, contributing significantly to advancements in the field of organic synthesis.