AD80090
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
50mg | 1 week | $1,590.00 | $1,113.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD80090 |
Chemical Name: | Quinapril Diketopiperazine |
CAS Number: | 103733-49-9 |
Molecular Formula: | C25H28N2O4 |
Molecular Weight: | 420.5008 |
MDL Number: | MFCD18252326 |
SMILES: | CCOC(=O)[C@@H](N1[C@@H](C)C(=O)N2[C@H](C1=O)Cc1c(C2)cccc1)CCc1ccccc1 |
Quinapril Diketopiperazine, also known as QDP, is a versatile compound widely utilized in chemical synthesis for the production of pharmaceutical agents. This unique molecule serves as a crucial building block in the synthesis of various drugs due to its structural properties and reactivity. In particular, QDP plays a key role in the formation of quinapril, a potent angiotensin-converting enzyme inhibitor used for the treatment of hypertension and heart failure.In chemical synthesis, Quinapril Diketopiperazine acts as a pivotal intermediate in the manufacturing process of quinapril and related pharmaceuticals. Its strategic incorporation allows for the precise control of reaction pathways and facilitates the synthesis of complex molecular structures. By serving as a crucial linker between different functional groups, QDP enables the efficient assembly of drug molecules with enhanced therapeutic properties.Furthermore, the unique reactivity of Quinapril Diketopiperazine offers chemists a high degree of control over stereoselectivity and regioselectivity in synthesis. This enables the production of enantiomerically pure compounds with desired biological activities and minimal side effects. Overall, the application of QDP in chemical synthesis demonstrates its significance in the development of advanced pharmaceuticals with improved efficacy and safety profiles.