103745-39-7 | Fasudil dihydrochloride

Packsize	Purity	Availability	Price	Discounted Price
250mg	98%	in stock	$41.00	$29.00
5g	98%	in stock	$318.00	$223.00

Description

• Catalog Number: AI06142
• Chemical Name: Fasudil dihydrochloride
• CAS Number: 103745-39-7
• Molecular Formula: C14H17N3O2S
• Molecular Weight: 291.36868
• MDL Number: MFCD00153805
• SMILES: O=S(=O)(c1cccc2c1ccnc2)N1CCNCCC1

Upstream Synthesis Route

5-[(Hexahydro-1H-1,4-diazepin-1-yl)sulfonyl]isoquinoline is a versatile compound widely used in chemical synthesis for its unique properties and reactivity. This compound serves as a valuable building block in organic chemistry, specifically in the formation of complex molecules and pharmaceutical intermediates. One of the key applications of 5-[(Hexahydro-1H-1,4-diazepin-1-yl)sulfonyl]isoquinoline is in the synthesis of bioactive compounds and heterocyclic structures. Its sulfonyl group allows for selective functionalization, making it an excellent precursor for the introduction of various functional groups in target molecules. Additionally, the isoquinoline moiety provides opportunities for further diversification through different chemical transformations.Moreover, this compound has found utility in the preparation of ligands, catalysts, and advanced materials due to its ability to participate in a variety of reactions such as nucleophilic substitution, cross-coupling, and cycloaddition reactions. Its unique molecular structure imparts specific properties that are valuable for designing new molecules with desired biological or physicochemical functions.Overall, 5-[(Hexahydro-1H-1,4-diazepin-1-yl)sulfonyl]isoquinoline plays a crucial role in the field of chemical synthesis by enabling the efficient construction of diverse organic compounds with potential applications in drug discovery, materials science, and chemical research.