logo
Home  > 5-Fluoro-4-methyl-2-nitrobenzoic acid

AW11331

103877-78-7 | 5-Fluoro-4-methyl-2-nitrobenzoic acid

Packsize Purity Availability Price Discounted Price    Quantity
1g 95% in stock $201.00 $141.00 -   +
5g 95% in stock $572.00 $400.00 -   +
10g 95% in stock $945.00 $661.00 -   +
25g 95% in stock $1,878.00 $1,315.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AW11331
Chemical Name: 5-Fluoro-4-methyl-2-nitrobenzoic acid
CAS Number: 103877-78-7
Molecular Formula: C8H6FNO4
Molecular Weight: 199.1359
MDL Number: MFCD28063998
SMILES: OC(=O)c1cc(F)c(cc1[N+](=O)[O-])C

 

Upstream Synthesis Route
  • 5-Fluoro-4-methyl-2-nitrobenzoic acid is a versatile compound commonly used in chemical synthesis as a key intermediate in the preparation of various pharmaceuticals and agrochemicals. This compound serves as a crucial building block for the synthesis of complex molecules due to its unique structural features and reactivity. In particular, its strategic placement of a fluorine atom, a methyl group, and a nitro group enables selective transformations that lead to the creation of diverse chemical entities.One of the primary applications of 5-Fluoro-4-methyl-2-nitrobenzoic acid is in the preparation of new drug candidates. By incorporating this compound into the molecular structure of potential pharmaceutical agents, chemists can modulate the properties of the final product, such as improving bioavailability, enhancing biological activity, or increasing metabolic stability. Additionally, the presence of the fluoro, methyl, and nitro groups in the molecule offers opportunities for further modifications through functional group interconversions, facilitating the fine-tuning of desired pharmacological properties.Furthermore, in the field of agrochemical synthesis, 5-Fluoro-4-methyl-2-nitrobenzoic acid plays a crucial role in the development of crop protection agents and pesticides. Its ability to participate in diverse chemical reactions allows for the construction of molecules with specific modes of action against target pests or pathogens, leading to the creation of effective and environmentally friendly agricultural products. The versatility of this compound in enabling the synthesis of structurally diverse molecules makes it a valuable tool for chemists involved in drug discovery and agrochemical research.
FEATURED PRODUCTS