AE51947
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 99% | 1 week | $106.00 | $74.00 | - + | |
5g | 99% | 1 week | $198.00 | $139.00 | - + | |
10g | 99% | 1 week | $307.00 | $215.00 | - + | |
25g | 99% | 1 week | $526.00 | $368.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE51947 |
Chemical Name: | Gemcitabine |
CAS Number: | 103882-84-4 |
Molecular Formula: | C9H11F2N3O4 |
Molecular Weight: | 263.1981 |
MDL Number: | MFCD00869720 |
SMILES: | OC[C@H]1OC(C([C@@H]1O)(F)F)n1ccc(nc1=O)N |
The compound 4-Amino-1-(2-deoxy-2,2-difluoro-D-erythro-pentofuranosyl)-2(1H)-pyrimidinone plays a crucial role in chemical synthesis as a key building block for the development of antiviral and antitumor agents. Its unique structure and properties make it a valuable intermediate in the synthesis of nucleoside analogs, which have shown promising potential in the treatment of various diseases. By incorporating this compound into organic synthesis routes, chemists can create novel molecules with enhanced biological activity and improved pharmacological properties. Its versatility and reactivity make it a valuable tool for drug discovery and development efforts in the pharmaceutical industry.