logo
Home  > 2'-Deoxy-2',2'-difluoroguanosine

AE22501

103882-87-7 | 2'-Deoxy-2',2'-difluoroguanosine

Availability
Typically In Stock

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AE22501
Chemical Name: 2'-Deoxy-2',2'-difluoroguanosine
CAS Number: 103882-87-7
Molecular Formula: C10H11F2N5O4
Molecular Weight: 303.2222
MDL Number: MFCD00870562
SMILES: OC[C@H]1O[C@H](C([C@@H]1O)(F)F)n1cnc2c1nc(N)[nH]c2=O

 

Upstream Synthesis Route 
  • 2'-Deoxy-2',2'-difluoro-guanosine is a vital compound in chemical synthesis, particularly in the field of nucleoside chemistry. This molecule plays a crucial role as a building block in the synthesis of nucleoside analogs and pharmaceuticals. Its unique structure, featuring fluorine atoms at specific positions, imparts distinct properties that are advantageous in drug design and development. In chemical synthesis, 2'-Deoxy-2',2'-difluoro-guanosine serves as a key intermediate for the creation of modified nucleosides with enhanced bioavailability, efficacy, and specificity. Its incorporation into nucleic acid sequences can lead to compounds with improved pharmacological profiles and potentially novel mechanisms of action. This compound's versatility and importance in synthetic chemistry make it a valuable tool for the creation of innovative pharmaceuticals and molecular probes.
FEATURED PRODUCTS