logo
Home  > 2,4-Dichloro-7-fluoro-8-methylquinazoline

AX50105

1039736-73-6 | 2,4-Dichloro-7-fluoro-8-methylquinazoline

Packsize Purity Availability Price Discounted Price    Quantity
100mg 95% in stock $12.00 $8.00 -   +
250mg 95% in stock $12.00 $9.00 -   +
1g 95% in stock $43.00 $31.00 -   +
5g 95% in stock $208.00 $146.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AX50105
Chemical Name: 2,4-Dichloro-7-fluoro-8-methylquinazoline
CAS Number: 1039736-73-6
Molecular Formula: C9H5Cl2FN2
Molecular Weight: 231.0538
MDL Number: MFCD27997107
SMILES: Clc1nc(Cl)c2c(n1)c(C)c(cc2)F

 

Upstream Synthesis Route 
  • The compound 2,4-Dichloro-7-fluoro-8-methylquinazoline plays a crucial role in chemical synthesis as a versatile building block. With its unique molecular structure, this compound serves as a valuable intermediate for the synthesis of various complex organic molecules. Its specific arrangement of chlorine, fluorine, and methyl groups enables precise manipulation and functionalization during synthetic processes. By incorporating 2,4-Dichloro-7-fluoro-8-methylquinazoline into a reaction scheme, chemists can access a wide array of derivatives and compounds with diverse properties and applications in pharmaceuticals, agrochemicals, and materials science.
FEATURED PRODUCTS