logo
Home  > 5-Chloro-N-(4-nitrophenyl)pentanamide

AI68094

1039914-85-6 | 5-Chloro-N-(4-nitrophenyl)pentanamide

Packsize Purity Availability Price Discounted Price    Quantity
250mg 97% in stock $16.00 $12.00 -   +
1g 97% in stock $62.00 $43.00 -   +
5g 97% in stock $210.00 $147.00 -   +
10g 97% in stock $378.00 $264.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AI68094
Chemical Name: 5-Chloro-N-(4-nitrophenyl)pentanamide
CAS Number: 1039914-85-6
Molecular Formula: C11H13ClN2O3
Molecular Weight: 256.68552
MDL Number: MFCD11192913
SMILES: ClCCCCC(=O)Nc1ccc(cc1)[N+](=O)[O-]

 

Upstream Synthesis Route 
  • Pentanamide, 5-chloro-N-(4-nitrophenyl)- is a versatile compound commonly used in chemical synthesis for various applications. This compound is particularly valuable in organic chemistry as a key building block for the synthesis of complex molecules. Its unique structure featuring a chloro and nitro group allows for selective chemical reactions and functional group transformations. In the field of medicinal chemistry, Pentanamide, 5-chloro-N-(4-nitrophenyl)- can be utilized in the development of pharmaceuticals targeting specific biological pathways. Additionally, this compound is employed in the synthesis of agrochemicals, dyes, and other specialty chemicals where precise control over molecular structure is crucial. Its versatility and reactivity make Pentanamide, 5-chloro-N-(4-nitrophenyl)- a valuable tool for chemists seeking to design and create new molecules with tailored properties.
FEATURED PRODUCTS