AB68098
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 98% | in stock | $15.00 | $10.00 | - + | |
1g | 98% | in stock | $16.00 | $11.00 | - + | |
5g | 98% | in stock | $23.00 | $16.00 | - + | |
10g | 98% | in stock | $30.00 | $21.00 | - + | |
25g | 98% | in stock | $44.00 | $31.00 | - + | |
100g | 98% | in stock | $124.00 | $87.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB68098 |
Chemical Name: | 4'-Nitroacetanilide |
CAS Number: | 104-04-1 |
Molecular Formula: | C8H8N2O3 |
Molecular Weight: | 180.1607 |
MDL Number: | MFCD00007303 |
SMILES: | CC(=O)Nc1ccc(cc1)[N+](=O)[O-] |
NSC Number: | 1315 |
Complexity: | 204 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 1 |
XLogP3: | 1.7 |
4-Nitroacetanilide is a versatile chemical compound commonly utilized in chemical synthesis due to its reactivity and unique properties. In organic chemistry, it serves as a key intermediate in the production of various pharmaceuticals, dyes, and agrochemicals. The presence of the nitro group on the acetanilide molecule makes 4-Nitroacetanilide a valuable precursor for synthesizing other important compounds through various chemical reactions, such as reduction, substitution, and coupling processes. Additionally, its ability to undergo nitration and subsequent functional group transformations allows for the creation of tailored molecules with specific properties for a wide range of applications. This compound plays a crucial role in the development of novel materials and substances, highlighting its significance in the field of chemical synthesis.
Applied microbiology and biotechnology 20120501
Rapid communications in mass spectrometry : RCM 20120315
Molecules and cells 20100501
Biotechnology and bioengineering 20090301
Journal of bioscience and bioengineering 20090101
Biological chemistry 20080401
Analytical biochemistry 20060815
Biochemical pharmacology 20060227
Biochemistry 20040127
Biochemistry 20020122
Molecular biotechnology 20010301
Journal of medicinal chemistry 19971205