AD70717
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 98% | in stock | $57.00 | $40.00 | - + | |
5mg | 98% | in stock | $249.00 | $174.00 | - + | |
25mg | 98% | in stock | $310.00 | $217.00 | - + | |
50mg | 98% | in stock | $478.00 | $335.00 | - + | |
100mg | 98% | in stock | $814.00 | $570.00 | - + | |
200mg | 98% | in stock | $1,318.00 | $923.00 | - + | |
500mg | 98% | in stock | $2,831.00 | $1,982.00 | - + | |
1g | 98% | in stock | $5,016.00 | $3,511.00 | - + | |
2g | 98% | in stock | $8,881.00 | $6,217.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD70717 |
Chemical Name: | Benzonatate |
CAS Number: | 104-31-4 |
Molecular Formula: | C30H53NO11 |
Molecular Weight: | 603.7419 |
MDL Number: | MFCD00072060 |
SMILES: | COCCOCCOCCOCCOCCOCCOCCOCCOCCOC(=O)c1ccc(cc1)NCCCC |
In chemical synthesis, Benzonatate serves as a valuable compound due to its unique properties and reactivity. Benzonatate is commonly used as a local anesthetic that works by numbing the sensory nerves in the lungs and respiratory tract, providing relief from coughing. In the realm of organic chemistry, Benzonatate can be utilized as a building block in the synthesis of various pharmaceuticals and organic compounds.Its benzene ring structure allows for versatile reactions such as electrophilic aromatic substitution, which enables the introduction of different functional groups onto the benzene ring. This versatility makes Benzonatate a valuable starting material for the synthesis of complex molecules. Additionally, the ester group in Benzonatate can undergo various transformations, contributing to its utility in chemical reactions.Overall, Benzonatate plays a crucial role in chemical synthesis by providing a starting point for the creation of diverse compounds. Its versatility and reactivity make it a valuable tool for organic chemists looking to design and construct novel molecules with specific properties and functions.