logo
Home  > Dibenzylidene ethylenediamine

AE09985

104-71-2 | Dibenzylidene ethylenediamine

Packsize Purity Availability Price Discounted Price    Quantity
250mg 95% in stock $35.00 $24.00 -   +
1g 95% in stock $57.00 $40.00 -   +
5g 95% in stock $133.00 $93.00 -   +
10g 95% in stock $233.00 $163.00 -   +
25g 95% in stock $448.00 $314.00 -   +
100g 95% in stock $1,317.00 $922.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AE09985
Chemical Name: Dibenzylidene ethylenediamine
CAS Number: 104-71-2
Molecular Formula: C16H16N2
Molecular Weight: 236.3116
MDL Number: MFCD00022040
SMILES: N(=Cc1ccccc1)CC/N=C/c1ccccc1

 

Upstream Synthesis Route 
  • N1,N2-Dibenzylideneethane-1,2-diamine is a versatile compound widely used in chemical synthesis as a chiral ligand in asymmetric catalysis. Its unique structure allows for the formation of stable complexes with various metal ions, such as copper and palladium, which can then facilitate a wide range of organic transformations with high enantioselectivity. This compound plays a crucial role in the efficient and selective synthesis of complex organic molecules, making it a valuable tool in the production of pharmaceuticals, agrochemicals, and specialty chemicals.
FEATURED PRODUCTS