10402-29-6 | Cupric nitrate

Availability
Typically In Stock

Description

• Catalog Number: AE08457
• Chemical Name: Cupric nitrate
• CAS Number: 10402-29-6
• Molecular Formula: CuN2O6
• Molecular Weight: 187.5558
• MDL Number: MFCD00149669
• SMILES: [N+](=O)([O-])[O-].[N+](=O)([O-])[O-].[Cu+2]

Upstream Synthesis Route

Nitric acid is a highly versatile and powerful chemical compound that finds extensive use in various chemical synthesis processes. When combined with copper salts, nitric acid serves as a crucial agent for creating a wide range of compounds and materials. In chemical synthesis, the combination of nitric acid and copper salt has been employed for the production of metal complexes, which are essential for catalytic reactions and the development of new materials. Additionally, this combination is commonly used in the pharmaceutical industry for the synthesis of organic compounds with diverse applications.The reactivity of nitric acid with copper salts allows for precise control over the oxidation states of the copper ions, leading to the formation of specific chemical intermediates that are vital in the synthesis of complex molecules. Moreover, the interaction between nitric acid and copper salt enables the modification of functional groups in organic molecules, enhancing their reactivity and altering their properties for various industrial applications. Overall, the utilization of nitric acid and copper salt in chemical synthesis showcases the significant role of these compounds in driving innovation and facilitating the development of novel materials and compounds across different industries.