AD45991
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $25.00 | $17.00 | - + | |
5g | 98% | in stock | $49.00 | $34.00 | - + | |
25g | 98% | in stock | $121.00 | $85.00 | - + | |
100g | 98% | in stock | $386.00 | $270.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD45991 |
Chemical Name: | 3-[4-(2-ethoxy-2-phenylethyl)piperazin-1-yl]-2-methyl-1-phenylpropan-1-one dihydrochloride |
CAS Number: | 10402-53-6 |
Molecular Formula: | C24H34Cl2N2O2 |
Molecular Weight: | 453.445 |
MDL Number: | MFCD01695215 |
SMILES: | CCOC(c1ccccc1)CN1CCN(CC1)CC(C(=O)c1ccccc1)C.Cl.Cl |
Complexity: | 450 |
Covalently-Bonded Unit Count: | 3 |
Heavy Atom Count: | 30 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 9 |
Undefined Atom Stereocenter Count: | 2 |
Eprazinone Dihydrochloride is a versatile compound commonly utilized in chemical synthesis as a key intermediate in the production of various pharmaceuticals and specialty chemicals. Its unique structure and reactivity make it a valuable tool for chemists seeking to create complex molecules in a controlled and efficient manner. By incorporating Eprazinone Dihydrochloride into synthetic routes, chemists can access new chemical entities with potential therapeutic applications or other specialized uses. Whether employed in the development of innovative medications or the synthesis of advanced materials, this compound plays a crucial role in advancing the field of synthetic chemistry.
International journal of pharmaceutics 20090331
Dermatology online journal 20051201