AB71820
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5mg | 1 week | $493.00 | $345.00 | - + | ||
10mg | 1 week | $833.00 | $583.00 | - + | ||
25mg | 1 week | $1,758.00 | $1,230.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB71820 |
Chemical Name: | Cefditoren sodium |
CAS Number: | 104146-53-4 |
Molecular Formula: | C19H18N6NaO5S3 |
Molecular Weight: | 529.5682 |
MDL Number: | MFCD01750404 |
SMILES: | CO/N=C(/C(=O)N[C@@H]1C(=O)N2[C@@H]1SCC(=C2C(=O)O)/C=C/c1scnc1C)\c1csc(n1)N.[Na+] |
Cefditoren sodium, a third-generation cephalosporin antibiotic, is a potent pharmaceutical agent widely utilized in chemical synthesis for its remarkable antimicrobial properties. With a unique molecular structure that imparts high stability and reactivity, Cefditoren sodium is commonly employed in the preparation of various chemical compounds, particularly in the pharmaceutical industry.In chemical synthesis, Cefditoren sodium serves as a key building block for the creation of complex molecules due to its ability to undergo selective reactions at specific functional groups. Its versatile nature allows it to participate in a wide range of synthetic transformations, making it a valuable asset in the development of novel medicinal compounds and biological agents.Furthermore, the use of Cefditoren sodium in chemical synthesis enables researchers and chemists to explore new pathways and strategies for the production of advanced pharmaceuticals with enhanced efficacy and reduced toxicity. By harnessing the unique properties of this compound, scientists can expedite the synthesis process, optimize reaction conditions, and achieve higher yields of desired products.Overall, the application of Cefditoren sodium in chemical synthesis represents a significant advancement in the field of medicinal chemistry, opening up opportunities for the creation of innovative drugs and therapeutic agents that can combat infectious diseases and improve patient outcomes. Evidencing its crucial role in synthetic chemistry, Cefditoren sodium continues to be a valuable tool for researchers and industry professionals seeking to push the boundaries of drug discovery and development.