AE11242
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 98% | in stock | $86.00 | $60.00 | - + | |
5mg | 98% | in stock | $378.00 | $264.00 | - + | |
10mg | 98% | in stock | $669.00 | $468.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE11242 |
Chemical Name: | IRAK inhibitor 1 |
CAS Number: | 1042224-63-4 |
Molecular Formula: | C17H19N5 |
Molecular Weight: | 293.36625999999995 |
MDL Number: | MFCD22124480 |
SMILES: | N1CCC(CC1)Nc1cccc(n1)c1cnc2n1cccc2 |
6-(Imidazo[1,2-a]pyridin-3-yl)-N-(piperidin-4-yl)pyridin-2-amine is a versatile compound commonly utilized in chemical synthesis as an intermediate for the creation of novel pharmaceuticals and organic compounds. This compound's unique structure and reactivity make it a valuable building block for the development of biologically active molecules. In the field of medicinal chemistry, it is often employed for the synthesis of potential drug candidates targeting various biological pathways. Its functional groups allow for the modification and manipulation of its properties to tune the desired characteristics of the final compound. Furthermore, the presence of both heterocyclic and aromatic moieties in the structure enables diverse chemical transformations, expanding the scope of its applications in synthetic chemistry.