logo
Home  > HC YELLOW NO. 6

AE52598

104333-00-8 | HC YELLOW NO. 6

Packsize Purity Availability Price Discounted Price    Quantity
50mg 98% 2 weeks $205.00 $144.00 -   +
100mg 98% 2 weeks $384.00 $269.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AE52598
Chemical Name: HC YELLOW NO. 6
CAS Number: 104333-00-8
Molecular Formula: C10H11F3N2O4
Molecular Weight: 280.2005
MDL Number: MFCD00270761
SMILES: OCC(CNc1ccc(cc1[N+](=O)[O-])C(F)(F)F)O

 

Upstream Synthesis Route 
  • The compound 3-((2-Nitro-4-(Trifluoromethyl)phenyl)amino)propane-1,2-diol holds a crucial role in chemical synthesis due to its unique structural arrangement and reactivity. In organic synthesis, this compound serves as a versatile building block for the preparation of various complex molecules. Its functional groups, including nitro, trifluoromethyl, and hydroxyl groups, enable it to participate in a range of synthetic reactions, such as nucleophilic substitution, reduction, and coupling reactions. This compound's ability to undergo diverse transformations makes it valuable for the synthesis of pharmaceuticals, agrochemicals, and materials with tailored properties. Additionally, the presence of both electron-withdrawing and electron-donating moieties in its structure contributes to its compatibility with a wide array of synthetic strategies, making it a valuable tool for chemical researchers aiming to access structurally diverse and biologically active compounds.
FEATURED PRODUCTS