AD80873
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 97% | in stock | $72.00 | $50.00 | - + | |
5g | 97% | in stock | $209.00 | $146.00 | - + | |
10g | 97% | in stock | $298.00 | $208.00 | - + | |
25g | 97% | in stock | $389.00 | $272.00 | - + | |
100g | 97% | in stock | $1,035.00 | $724.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD80873 |
Chemical Name: | 2'-Deoxy-5'-o-dmt-5-iodouridine |
CAS Number: | 104375-88-4 |
Molecular Formula: | C30H29IN2O7 |
Molecular Weight: | 656.4649 |
MDL Number: | MFCD01631069 |
SMILES: | COc1ccc(cc1)C(c1ccc(cc1)OC)(c1ccccc1)OC[C@H]1O[C@H](C[C@@H]1O)n1cc(I)c(=O)[nH]c1=O |
1-((2R,4S,5R)-5-((Bis(4-methoxyphenyl)(phenyl)methoxy)methyl)-4-hydroxytetrahydrofuran-2-yl)-5-iodopyrimidine-2,4(1H,3H)-dione, known for its complex structure and diverse reactivity, serves as a valuable reagent in chemical synthesis. This compound is particularly sought after for its ability to act as a versatile building block in the construction of more intricate organic molecules. Due to its unique molecular composition, it can participate in a variety of synthetic transformations, such as cross-coupling reactions, nucleophilic substitutions, and oxidative additions. Additionally, its specific stereochemistry and functional groups make it a desirable intermediate in the synthesis of biologically active compounds and pharmaceutical ingredients. Researchers and chemists utilize this compound as a key component in the strategic design and development of novel chemical entities, showcasing its significance in advancing the field of organic synthesis.