AD49506
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $282.00 | $197.00 | - + | |
1g | 95% | in stock | $649.00 | $454.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD49506 |
Chemical Name: | 1-Acetyl-1H-indole-2-carboxylic acid |
CAS Number: | 10441-26-6 |
Molecular Formula: | C11H9NO3 |
Molecular Weight: | 203.1941 |
MDL Number: | MFCD02258917 |
SMILES: | OC(=O)c1cc2c(n1C(=O)C)cccc2 |
1-Acetyl-1H-indole-2-carboxylic acid, also known as $name$, is a versatile compound widely used in chemical synthesis for its unique properties and reactivity. This compound serves as a valuable building block in the synthesis of various organic molecules, particularly in the field of medicinal chemistry and pharmaceuticals.$name$ can be utilized as a key intermediate in the development of novel drugs and bioactive compounds due to its ability to undergo diverse chemical transformations. It is commonly employed in the synthesis of indole derivatives, which are important structural motifs found in numerous biologically active molecules such as pharmaceuticals, agrochemicals, and natural products.In addition, $name$ can be functionalized at different positions on the indole ring, leading to the formation of structurally diverse compounds with varying properties and activities. Its versatility in chemical synthesis makes it an essential reagent for organic chemists seeking to access a wide range of complex molecules through strategic bond formations and modifications.Overall, the application of 1-Acetyl-1H-indole-2-carboxylic acid in chemical synthesis offers researchers and chemists a powerful tool for designing and constructing innovative compounds with potential therapeutic relevance and biological activities.