logo
Home  > 1-(6-Hydroxynaphthalen-2-yl)ethanone

AE12538

10441-41-5 | 1-(6-Hydroxynaphthalen-2-yl)ethanone

Packsize Purity Availability Price Discounted Price    Quantity
100mg 98% in stock $34.00 $24.00 -   +
250mg 98% in stock $72.00 $51.00 -   +
5g 98% in stock $937.00 $656.00 -   +
10g 98% in stock $1,691.00 $1,184.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AE12538
Chemical Name: 1-(6-Hydroxynaphthalen-2-yl)ethanone
CAS Number: 10441-41-5
Molecular Formula: C12H10O2
Molecular Weight: 186.2066
MDL Number: MFCD00127709
SMILES: Oc1ccc2c(c1)ccc(c2)C(=O)C

 

Upstream Synthesis Route
  • 1-(6-Hydroxynaphthalen-2-yl)ethanone, also known as $name$, is a versatile compound widely utilized in chemical synthesis processes. This compound acts as a key intermediate in the production of various pharmaceuticals, agrochemicals, and specialty chemicals. Its unique structure and reactivity make it a valuable building block in organic chemistry.In chemical synthesis, 1-(6-Hydroxynaphthalen-2-yl)ethanone serves as a crucial starting material for the preparation of complex organic molecules. Its functional groups can undergo a range of valuable chemical transformations including acylation, alkylation, and condensation reactions. By incorporating this compound into synthetic routes, chemists can efficiently access diverse chemical structures with specific properties and functionalities.Furthermore, the presence of the hydroxyl group in 1-(6-Hydroxynaphthalen-2-yl)ethanone enables the synthesis of heterocyclic compounds and natural products through cyclization reactions. This compound's ability to participate in diverse chemical reactions makes it a valuable tool for the design and development of novel molecules with potential applications in various industries.Overall, 1-(6-Hydroxynaphthalen-2-yl)ethanone plays a crucial role in chemical synthesis by enabling the construction of complex molecules with enhanced properties and functionalities. Its versatility and reactivity make it a valuable asset for researchers and chemists seeking to innovate and advance in the field of organic chemistry.
FEATURED PRODUCTS