AD70132
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 98% | in stock | $42.00 | $29.00 | - + | |
5mg | 98% | in stock | $85.00 | $59.00 | - + | |
10mg | 98% | in stock | $136.00 | $95.00 | - + | |
25mg | 98% | in stock | $255.00 | $178.00 | - + | |
50mg | 98% | in stock | $432.00 | $302.00 | - + | |
100mg | 98% | in stock | $736.00 | $515.00 | - + | |
250mg | 98% | in stock | $1,396.00 | $977.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD70132 |
Chemical Name: | CAY10603 |
CAS Number: | 1045792-66-2 |
Molecular Formula: | C22H30N4O6 |
Molecular Weight: | 446.4968 |
MDL Number: | MFCD17010286 |
SMILES: | ONC(=O)CCCCCCNC(=O)c1noc(c1)c1ccc(cc1)NC(=O)OC(C)(C)C |
Complexity: | 616 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 32 |
Hydrogen Bond Acceptor Count: | 7 |
Hydrogen Bond Donor Count: | 4 |
Rotatable Bond Count: | 12 |
XLogP3: | 2.6 |
Carbamic acid, N-[4-[3-[[[7-(hydroxyamino)-7-oxoheptyl]amino]carbonyl]-5-isoxazolyl]phenyl]-, 1,1-dimethylethyl ester is a versatile compound used in chemical synthesis for the preparation of various pharmaceuticals, agrochemicals, and specialty chemicals. It serves as a key intermediate in the synthesis of complex molecules due to its unique structure and reactivity. This compound plays a crucial role in the creation of novel chemical entities with potential therapeutic applications. Its usage in chemical synthesis enables the development of new materials and compounds that have diverse industrial and research applications.
The Journal of pharmacology and experimental therapeutics 20170101
Journal of medicinal chemistry 20130822
Bioorganic & medicinal chemistry letters 20130801
Bioorganic & medicinal chemistry letters 20101201
Journal of medicinal chemistry 20080814