AE11039
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 98% | 2 weeks | $361.00 | $253.00 | - + | |
250mg | 98% | 2 weeks | $892.00 | $625.00 | - + | |
1g | 98% | 2 weeks | $2,220.00 | $1,554.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE11039 |
Chemical Name: | Ethyl- 5-methoxy-1H-Pyrrolo[2,3-b]pyridine-2-carboxylate |
CAS Number: | 1045856-81-2 |
Molecular Formula: | C11H12N2O3 |
Molecular Weight: | 220.22458 |
MDL Number: | MFCD15529007 |
SMILES: | CCOC(=O)c1cc2c([nH]1)ncc(c2)OC |
Ethyl-5-methoxy-1H-Pyrrolo[2,3-b]pyridine-2-carboxylate is a versatile chemical compound that finds wide application in organic synthesis. Its unique molecular structure makes it a valuable building block for the preparation of various pharmaceutical compounds, agrochemicals, and materials.In chemical synthesis, Ethyl-5-methoxy-1H-Pyrrolo[2,3-b]pyridine-2-carboxylate serves as a key intermediate in the production of biologically active molecules due to its functional groups and reactivity. It can undergo various transformations such as nucleophilic substitutions, condensation reactions, and cyclizations to introduce desired moieties into the target molecules.The presence of the ester group in Ethyl-5-methoxy-1H-Pyrrolo[2,3-b]pyridine-2-carboxylate allows for selective modification at that position, enabling the synthesis of diverse derivatives with altered properties and functions. Its structural features make it suitable for the construction of heterocyclic frameworks, which are commonly found in many pharmaceuticals and natural products.Overall, Ethyl-5-methoxy-1H-Pyrrolo[2,3-b]pyridine-2-carboxylate plays a crucial role in the advancement of chemical synthesis by facilitating the efficient and precise production of complex molecules with potential applications in various fields.