logo
Home  > 9-Chloro-2-(furan-2-yl)-[1,2,4]triazolo[1,5-c]quinazolin-5-amine

AE08114

104615-18-1 | 9-Chloro-2-(furan-2-yl)-[1,2,4]triazolo[1,5-c]quinazolin-5-amine

Packsize Purity Availability Price Discounted Price    Quantity
5mg 5% in stock $74.00 $52.00 -   +
10mg 5% in stock $115.00 $80.00 -   +
25mg 5% in stock $178.00 $125.00 -   +
50mg 5% in stock $263.00 $184.00 -   +
100mg 5% in stock $413.00 $289.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AE08114
Chemical Name: 9-Chloro-2-(furan-2-yl)-[1,2,4]triazolo[1,5-c]quinazolin-5-amine
CAS Number: 104615-18-1
Molecular Formula: C13H8ClN5O
Molecular Weight: 285.6885
MDL Number: MFCD01529897
SMILES: Clc1ccc2c(c1)c1nc(nn1c(n2)N)c1ccco1

 

Upstream Synthesis Route 
  • 9-Chloro-2-(2-furanyl)[1,2,4]triazolo[1,5-c]quinazolin-5-amine is a versatile compound that finds important applications in chemical synthesis. It serves as a key intermediate in the synthesis of various pharmaceutical agents and bioactive compounds. Due to its unique structure and reactivity, this compound can undergo a variety of chemical transformations, including functional group interconversions, heterocyclizations, and cross-coupling reactions. Its presence in a synthetic pathway can lead to the formation of structurally diverse molecules with potential pharmacological activities. Additionally, the incorporation of 9-Chloro-2-(2-furanyl)[1,2,4]triazolo[1,5-c]quinazolin-5-amine in complex molecule synthesis allows for the development of new drug candidates and chemical probes for biological studies.
FEATURED PRODUCTS