AB64008
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 95% | in stock | $30.00 | $21.00 | - + | |
25g | 95% | in stock | $606.00 | $424.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB64008 |
Chemical Name: | 3,5-DINITRO-4-HYDROXYPHENYLACETIC ACID |
CAS Number: | 10463-37-3 |
Molecular Formula: | C8H6N2O7 |
Molecular Weight: | 242.14244 |
MDL Number: | MFCD00016995 |
SMILES: | OC(=O)Cc1cc([N+](=O)[O-])c(c(c1)[N+](=O)[O-])O |
3,5-DINITRO-4-HYDROXYPHENYLACETIC ACID is a valuable compound utilized in chemical synthesis for its ability to function as a versatile building block in organic reactions. This compound is commonly employed in the synthesis of various pharmaceuticals, agrochemicals, and advanced materials. Its unique chemical properties make it a key ingredient in the creation of complex molecular structures, enabling the formation of new compounds with distinctive properties. In addition, 3,5-DINITRO-4-HYDROXYPHENYLACETIC ACID plays a crucial role in the development of cutting-edge research compounds and materials, further cementing its importance in the realm of chemical synthesis.