AE22381
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $465.00 | $325.00 | - + | |
250mg | 95% | in stock | $545.00 | $381.00 | - + | |
1g | 95% | in stock | $1,603.00 | $1,122.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE22381 |
Chemical Name: | 5-(TRIBUTYLSTANNYL)THIAZOLE-2-CARBALDEHYDE |
CAS Number: | 1046498-44-5 |
Molecular Formula: | C16H29NOSSn |
Molecular Weight: | 402.1736 |
MDL Number: | MFCD16170449 |
SMILES: | CCCC[Sn](c1cnc(s1)C=O)(CCCC)CCCC |
5-(Tributylstannyl)thiazole-2-carbaldehyde is a versatile chemical reagent commonly employed in organic synthesis for various applications. This compound serves as a useful building block in the preparation of complex molecules and functional materials. Its unique structure allows for selective modifications and transformations, making it a valuable tool in the field of chemical synthesis.One key application of 5-(Tributylstannyl)thiazole-2-carbaldehyde is in the field of Medicinal Chemistry. Its ability to participate in various organic reactions, such as cross-coupling reactions and functional group manipulations, enables the synthesis of novel pharmaceutical compounds with potentially enhanced biological activities. Researchers can use this compound as a key intermediate in the preparation of drug candidates and lead compounds for further biological evaluation.Furthermore, 5-(Tributylstannyl)thiazole-2-carbaldehyde finds utility in the synthesis of advanced materials such as polymers, dendrimers, and sensors. Its reactive nature allows for the attachment of specific functional groups or polymers, leading to the development of tailored materials with desired properties. By incorporating this compound into the molecular design of materials, researchers can achieve enhanced performance characteristics and targeted applications in various industrial fields.In summary, the use of 5-(Tributylstannyl)thiazole-2-carbaldehyde in chemical synthesis offers a wide range of possibilities for creating intricate molecular structures and functional materials with diverse applications in Medicinal Chemistry and material science. Its utility in organic transformations makes it a valuable component in the toolbox of synthetic chemists working on the forefront of innovative research and development.