AE24478
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $95.00 | $67.00 | - + | |
250mg | 95% | in stock | $149.00 | $104.00 | - + | |
1g | 95% | in stock | $532.00 | $372.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE24478 |
Chemical Name: | 1-Methylcyclopropyl 4-nitrophenyl carbonate |
CAS Number: | 1046817-22-4 |
Molecular Formula: | C11H11NO5 |
Molecular Weight: | 237.2087 |
MDL Number: | MFCD17014665 |
SMILES: | O=C(Oc1ccc(cc1)[N+](=O)[O-])OC1(C)CC1 |
1-Methylcyclopropyl (4-nitrophenyl) carbonate is a versatile chemical compound that finds wide application in chemical synthesis processes. It serves as a valuable building block in the creation of various organic compounds due to its unique reactivity and structural properties.In chemical synthesis, 1-Methylcyclopropyl (4-nitrophenyl) carbonate can be used as a key reagent for the formation of carbon-carbon bonds through the process of carbonylation reactions. This compound's cyclopropyl group imparts interesting steric effects, making it particularly useful in controlling regioselectivity and stereochemistry during the synthesis of complex molecules.Furthermore, the nitrophenyl functionality in 1-Methylcyclopropyl (4-nitrophenyl) carbonate allows for selective chemical transformations, enabling chemists to introduce specific functional groups at desired positions within a molecule. This flexibility makes it a valuable tool in constructing organic frameworks with precision and efficiency.Overall, the application of 1-Methylcyclopropyl (4-nitrophenyl) carbonate in chemical synthesis demonstrates its importance as a strategic reagent for organic chemists seeking to access novel structures and functionalities in their synthetic endeavors.