AE13016
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
25g | 2 weeks | $210.00 | $147.00 | - + | ||
100g | 2 weeks | $682.00 | $478.00 | - + | ||
1kg | 2 weeks | $1,362.00 | $953.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE13016 |
Chemical Name: | CARBINOL (HYDROXYL) TERMINATED POLYDIMETHYLSILOXANE |
CAS Number: | 104780-66-7 |
Molecular Formula: | C12H32O4Si3 |
Molecular Weight: | 324.6366 |
MDL Number: | MFCD00241457 |
SMILES: | C[Si](C)(CCCO)O[Si](C)(C)O[Si](C)(C)CCCO |
Siloxanes and silicones containing a di-Me, 3-hydroxypropyl group-terminated structure are versatile compounds widely utilized in chemical synthesis. These compounds play a crucial role in various applications within the field of chemistry. Their unique chemical properties make them valuable building blocks for the creation of advanced materials and specialty chemicals. By incorporating the di-Me, 3-hydroxypropyl group-terminated siloxanes and silicones into synthetic processes, chemists are able to enhance the functionality and performance of a wide range of products. Whether used as adhesives, coatings, sealants, or in other applications, these specialized compounds offer exceptional chemical stability and reactivity, making them indispensable tools for innovative chemical synthesis.