AE11278
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 99% | in stock | $9.00 | $6.00 | - + | |
5mg | 99% | in stock | $23.00 | $16.00 | - + | |
10mg | 99% | in stock | $35.00 | $24.00 | - + | |
25mg | 99% | in stock | $58.00 | $40.00 | - + | |
50mg | 99% | in stock | $95.00 | $66.00 | - + | |
100mg | 99% | in stock | $160.00 | $112.00 | - + | |
250mg | 99% | in stock | $272.00 | $190.00 | - + | |
1g | 99% | in stock | $729.00 | $510.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE11278 |
Chemical Name: | MI 2 MALT1 inhibitor |
CAS Number: | 1047953-91-2 |
Molecular Formula: | C19H17Cl3N4O3 |
Molecular Weight: | 455.7222799999998 |
MDL Number: | MFCD19754074 |
SMILES: | COCCOc1nn(c(n1)c1ccc(c(c1)Cl)Cl)c1ccc(cc1)NC(=O)CCl |
Complexity: | 525 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 29 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 8 |
XLogP3: | 4.5 |
MI-2 MALT1 inhibitor is a potent chemical compound known for its crucial role in chemical synthesis. By selectively inhibiting the MALT1 enzyme, this inhibitor effectively suppresses the downstream signaling pathway, making it a versatile tool in various synthetic processes. In the realm of chemical synthesis, MI-2 MALT1 inhibitor acts as a key catalyst, facilitating the efficient and specific formation of desired molecular structures. Its targeted inhibition mechanism allows for precise control over reactions, leading to enhanced yields and purity in the synthesis of complex compounds. Furthermore, this inhibitor plays a significant role in medicinal chemistry, enabling the development of novel drugs and therapeutic agents with high precision and efficacy. In summary, the application of MI-2 MALT1 inhibitor in chemical synthesis offers a promising pathway towards advancing synthetic methodologies and achieving breakthroughs in pharmaceutical research and development.