logo
Home  > Inhibitors/Agonists  > Immunology/Inflammation  > MALT1  > MI 2 MALT1 inhibitor

AE11278

1047953-91-2 | MI 2 MALT1 inhibitor

Packsize Purity Availability Price Discounted Price    Quantity
1mg 99% in stock $9.00 $6.00 -   +
5mg 99% in stock $23.00 $16.00 -   +
10mg 99% in stock $35.00 $24.00 -   +
25mg 99% in stock $58.00 $40.00 -   +
50mg 99% in stock $95.00 $66.00 -   +
100mg 99% in stock $160.00 $112.00 -   +
250mg 99% in stock $272.00 $190.00 -   +
1g 99% in stock $729.00 $510.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AE11278
Chemical Name: MI 2 MALT1 inhibitor
CAS Number: 1047953-91-2
Molecular Formula: C19H17Cl3N4O3
Molecular Weight: 455.7222799999998
MDL Number: MFCD19754074
SMILES: COCCOc1nn(c(n1)c1ccc(c(c1)Cl)Cl)c1ccc(cc1)NC(=O)CCl

 

Computed Properties
Complexity: 525  
Covalently-Bonded Unit Count: 1  
Heavy Atom Count: 29  
Hydrogen Bond Acceptor Count: 5  
Hydrogen Bond Donor Count: 1  
Rotatable Bond Count: 8  
XLogP3: 4.5  

 

 

Upstream Synthesis Route
  • MI-2 MALT1 inhibitor is a potent chemical compound known for its crucial role in chemical synthesis. By selectively inhibiting the MALT1 enzyme, this inhibitor effectively suppresses the downstream signaling pathway, making it a versatile tool in various synthetic processes. In the realm of chemical synthesis, MI-2 MALT1 inhibitor acts as a key catalyst, facilitating the efficient and specific formation of desired molecular structures. Its targeted inhibition mechanism allows for precise control over reactions, leading to enhanced yields and purity in the synthesis of complex compounds. Furthermore, this inhibitor plays a significant role in medicinal chemistry, enabling the development of novel drugs and therapeutic agents with high precision and efficacy. In summary, the application of MI-2 MALT1 inhibitor in chemical synthesis offers a promising pathway towards advancing synthetic methodologies and achieving breakthroughs in pharmaceutical research and development.
FEATURED PRODUCTS