logo
Home  > (R)-6,7-Dimethoxy-2-methyl-1-(3,4,5-trimethoxybenzyl)-1,2,3,4-tetrahydroisoquinoline (2R,3R)-2,3-bis(benzoyloxy)succinate

AY22194

104832-01-1 | (R)-6,7-Dimethoxy-2-methyl-1-(3,4,5-trimethoxybenzyl)-1,2,3,4-tetrahydroisoquinoline (2R,3R)-2,3-bis(benzoyloxy)succinate

Packsize Purity Availability Price Discounted Price    Quantity
100mg 97% 2 weeks $413.00 $289.00 -   +
250mg 97% 2 weeks $677.00 $474.00 -   +
1g 97% 2 weeks $1,336.00 $936.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AY22194
Chemical Name: (R)-6,7-Dimethoxy-2-methyl-1-(3,4,5-trimethoxybenzyl)-1,2,3,4-tetrahydroisoquinoline (2R,3R)-2,3-bis(benzoyloxy)succinate
CAS Number: 104832-01-1
Molecular Formula: C39H41NO13
Molecular Weight: 731.7417
MDL Number: MFCD29904971
SMILES: OC(=O)[C@@H]([C@H](C(=O)O)OC(=O)c1ccccc1)OC(=O)c1ccccc1.COc1cc2CCN[C@@H](c2cc1OC)Cc1cc(OC)c(c(c1)OC)OC

 

Upstream Synthesis Route 
  • The compound Butanedioic acid, 2,3-bis(benzoyloxy)-, (2R,3R)-, compd. with (1R)-1,2,3,4-tetrahydro-6,7-dimethoxy-2-methyl-1-[(3,4,5-trimethoxyphenyl)methyl]isoquinoline (1:1) is utilized in chemical synthesis as a key component for creating various complex organic molecules. This compound plays a crucial role in the formation of intricate structures through controlled reactions and transformations. Its ability to participate in specific chemical reactions leads to the development of novel compounds with unique properties and applications in pharmaceuticals, materials science, and other fields of research.
FEATURED PRODUCTS