AB64473
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 95% | in stock | $106.00 | $75.00 | - + | |
5g | 95% | in stock | $281.00 | $197.00 | - + | |
25g | 95% | in stock | $1,154.00 | $808.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB64473 |
Chemical Name: | 3-Bromo-4-methyl-5-nitro-2-pyridinone |
CAS Number: | 1049706-72-0 |
Molecular Formula: | C6H5BrN2O3 |
Molecular Weight: | 233.0195 |
MDL Number: | MFCD12828179 |
SMILES: | [O-][N+](=O)c1c[nH]c(=O)c(c1C)Br |
Complexity: | 313 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
XLogP3: | 0.6 |
3-Bromo-4-methyl-5-nitro-2-pyridinone is a versatile compound commonly utilized in chemical synthesis for its unique properties and reactivity. This compound serves as a valuable building block in the creation of various organic molecules with enhanced functionalities. In chemical synthesis, 3-Bromo-4-methyl-5-nitro-2-pyridinone acts as a key intermediate in the formation of heterocyclic compounds, pharmaceuticals, and agrochemicals. Through its ability to undergo diverse reactions, such as nucleophilic substitution and cyclization, this compound plays a crucial role in the development of new drug candidates, pesticides, and materials with specialized properties. Additionally, 3-Bromo-4-methyl-5-nitro-2-pyridinone serves as a vital tool in the modification of complex molecular structures, offering chemists a precise and efficient method for synthesizing advanced organic compounds with tailored properties and applications.