AB54922
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $36.00 | $25.00 | - + | |
1g | 95% | in stock | $38.00 | $26.00 | - + | |
5g | 95% | in stock | $164.00 | $115.00 | - + | |
10g | 95% | in stock | $317.00 | $222.00 | - + | |
25g | 95% | in stock | $664.00 | $465.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB54922 |
Chemical Name: | Benzyl (2s,3r)-(+)-6-oxo-2,3-diphenyl-4-morpholinecarboxylate |
CAS Number: | 105228-46-4 |
Molecular Formula: | C24H21NO4 |
Molecular Weight: | 387.4278 |
MDL Number: | MFCD00074956 |
SMILES: | O=C1O[C@@H](c2ccccc2)[C@H](N(C1)C(=O)OCc1ccccc1)c1ccccc1 |
Complexity: | 547 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 2 |
Heavy Atom Count: | 29 |
Hydrogen Bond Acceptor Count: | 4 |
Rotatable Bond Count: | 5 |
XLogP3: | 4.4 |
The Journal of organic chemistry 20020906
Organic letters 20011227