AB78323
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $19.00 | $13.00 | - + | |
1g | 95% | in stock | $32.00 | $22.00 | - + | |
5g | 95% | in stock | $58.00 | $40.00 | - + | |
10g | 95% | in stock | $86.00 | $60.00 | - + | |
25g | 95% | in stock | $202.00 | $141.00 | - + | |
100g | 95% | in stock | $805.00 | $564.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB78323 |
Chemical Name: | Phosphoenolpyruvic acid cyclohexylammonium salt |
CAS Number: | 10526-80-4 |
Molecular Formula: | C9H18NO6P |
Molecular Weight: | 267.216081 |
MDL Number: | MFCD00036375 |
SMILES: | OC(=O)C(=C)OP(=O)(O)O.NC1CCCCC1 |
Complexity: | 247 |
Covalently-Bonded Unit Count: | 2 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 7 |
Hydrogen Bond Donor Count: | 4 |
Rotatable Bond Count: | 3 |
Cyclohexanamine 2-(phosphonooxy)acrylate is a versatile compound commonly used in chemical synthesis due to its unique properties and reactivity. As a key intermediate in organic reactions, it serves as a valuable building block in the creation of various functional materials and bioactive compounds. One of the primary applications of Cyclohexanamine 2-(phosphonooxy)acrylate is in the synthesis of polymers and copolymers. Its ability to polymerize under certain conditions makes it a crucial element in the production of specialized polymers with specific properties, such as solubility, conductivity, or flexibility. Additionally, the compound's presence in copolymers allows for the fine-tuning of material characteristics for a wide range of industrial applications.Furthermore, Cyclohexanamine 2-(phosphonooxy)acrylate is utilized in the preparation of pharmaceutical intermediates and agrochemicals. By incorporating this compound into synthetic pathways, chemists can modify the structure of drug candidates or pesticides to optimize their efficacy and safety profiles. Its reactivity towards various functional groups enables the introduction of important pharmacophores or active ingredients into the final products.In summary, Cyclohexanamine 2-(phosphonooxy)acrylate plays a crucial role in chemical synthesis, particularly in the creation of polymers, copolymers, pharmaceutical intermediates, and agrochemicals. Its versatility and reactivity make it a sought-after compound for researchers and industrial chemists alike seeking to develop innovative materials and bioactive molecules.