AB50586
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 98% | in stock | $12.00 | $8.00 | - + | |
250mg | 98% | in stock | $18.00 | $13.00 | - + | |
1g | 98% | in stock | $21.00 | $15.00 | - + | |
5g | 98% | in stock | $84.00 | $59.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB50586 |
Chemical Name: | 2,4,5-Trichloro-7h-pyrrolo[2,3-d]pyrimidine |
CAS Number: | 1053228-28-6 |
Molecular Formula: | C6H2Cl3N3 |
Molecular Weight: | 222.4592 |
MDL Number: | MFCD13193620 |
SMILES: | Clc1nc(Cl)c2c(n1)[nH]cc2Cl |
Complexity: | 179 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
XLogP3: | 3.2 |
2,4,5-Trichloro-7H-pyrrolo[2,3-d]pyrimidine is a versatile compound widely utilized in chemical synthesis due to its unique reactivity and structural properties. In the field of organic chemistry, this compound serves as a valuable building block for the synthesis of various complex organic molecules. Its trichloro substitution pattern makes it an attractive reagent for facilitating diverse chemical transformations, such as nucleophilic substitution reactions and cross-coupling reactions. Additionally, the pyrrolopyrimidine moiety confers specific electronic and steric characteristics that can be exploited in the design of targeted pharmaceuticals and agrochemicals. Overall, the strategic incorporation of 2,4,5-trichloro-7H-pyrrolo[2,3-d]pyrimidine in synthetic routes enables the creation of novel compounds with tailored properties and enhanced biological activities.