AB51422
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 98% | in stock | $12.00 | $9.00 | - + | |
250mg | 98% | in stock | $24.00 | $17.00 | - + | |
1g | 98% | in stock | $70.00 | $49.00 | - + | |
5g | 98% | in stock | $229.00 | $161.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB51422 |
Chemical Name: | tert-Butyl 4-chloro-5,6-dihydropyrido[3,4-d]pyrimidine-7(8h)-carboxylate |
CAS Number: | 1053656-57-7 |
Molecular Formula: | C12H16ClN3O2 |
Molecular Weight: | 269.7273 |
MDL Number: | MFCD11109465 |
SMILES: | O=C(N1CCc2c(C1)ncnc2Cl)OC(C)(C)C |
Tert-Butyl 4-chloro-5,6-dihydropyrido[3,4-d]pyrimidine-7(8H)-carboxylate is a valuable compound commonly used in chemical synthesis. This particular compound serves as a versatile building block in the creation of various pharmaceuticals, agrochemicals, and materials. Due to its unique structure and reactivity, it participates in a wide range of reactions to form complex molecules with diverse functionalities. Chemists often utilize tert-Butyl 4-chloro-5,6-dihydropyrido[3,4-d]pyrimidine-7(8H)-carboxylate as a key intermediate in the synthesis of biologically active compounds, making it an essential component in the field of medicinal chemistry and drug discovery.