1053657-29-6 | tert-Butyl 2-(1-((furan-2-ylmethyl)amino)-2-phenylethylidene)hydrazinecarboxylate

Availability
Typically In Stock

Description

• Catalog Number: AX83108
• Chemical Name: tert-Butyl 2-(1-((furan-2-ylmethyl)amino)-2-phenylethylidene)hydrazinecarboxylate
• CAS Number: 1053657-29-6
• MDL Number: MFCD10568247
• SMILES: O=C(OC(C)(C)C)N/N=C(Cc1ccccc1)/NCc1ccco1

Upstream Synthesis Route

The N'-[1-[(Furan-2-ylmethyl)amino]2-phenylethylidene] hydrazinecarboxylic Acid tert-Butyl Ester, abbreviated as $name$, is a valuable compound widely employed in chemical synthesis due to its versatile applications. In organic chemistry, $name$ acts as a key building block in the synthesis of various pharmaceuticals, agrochemicals, and functional materials. Its unique structure and reactivity make it a crucial intermediate in the development of novel compounds with potential biological activities. By serving as a precursor molecule in multistep synthetic processes, $name$ enables chemists to access a diverse range of structurally complex molecules efficiently. Additionally, its tert-butyl ester functional group offers protection for sensitive functional groups during different synthetic transformations, enhancing the overall synthetic efficiency and selectivity. By leveraging the synthetic potential of $name$, researchers can explore new chemical pathways towards the creation of innovative molecules with diverse applications.