logo
Home  > tert-Butyl 4-acetylbenzoate

AE20221

105580-41-4 | tert-Butyl 4-acetylbenzoate

Packsize Purity Availability Price Discounted Price    Quantity
100mg 98% in stock $15.00 $10.00 -   +
1g 98% in stock $17.00 $12.00 -   +
100g 98% in stock $1,317.00 $922.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AE20221
Chemical Name: tert-Butyl 4-acetylbenzoate
CAS Number: 105580-41-4
Molecular Formula: C13H16O3
Molecular Weight: 220.2643
MDL Number: MFCD17676586
SMILES: O=C(c1ccc(cc1)C(=O)C)OC(C)(C)C

 

Upstream Synthesis Route 
  • Known for its versatility in chemical synthesis, tert-Butyl 4-acetylbenzoate is a valuable compound that finds wide application in organic chemistry processes. This compound serves as a key building block in the creation of various pharmaceuticals, fragrances, and advanced materials. Its unique structure allows for strategic manipulation in reactions to introduce specific functionalities or structural motifs into the target compounds. tert-Butyl 4-acetylbenzoate is particularly useful in the synthesis of complex molecules where precise control over regioselectivity and stereochemistry is crucial. Its presence in a reaction mixture often leads to improved yields and selectivity, making it a preferred choice in the development of novel chemical entities.
FEATURED PRODUCTS