logo
Home  > 4-Bromo-3-fluoro-n-methylbenzenesulfonamide

AE26923

1055995-78-2 | 4-Bromo-3-fluoro-n-methylbenzenesulfonamide

Packsize Purity Availability Price Discounted Price    Quantity
250mg 95% in stock $137.00 $96.00 -   +
1g 95% in stock $330.00 $231.00 -   +
5g 95% in stock $945.00 $661.00 -   +
10g 95% in stock $1,504.00 $1,053.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AE26923
Chemical Name: 4-Bromo-3-fluoro-n-methylbenzenesulfonamide
CAS Number: 1055995-78-2
Molecular Formula: C7H7BrFNO2S
Molecular Weight: 268.1034
MDL Number: MFCD18426207
SMILES: CNS(=O)(=O)c1ccc(c(c1)F)Br

 

Upstream Synthesis Route 
  • 4-Bromo-3-fluoro-N-methylbenzenesulfonamide is a versatile chemical compound commonly used in chemical synthesis processes. This compound serves as a valuable building block in the creation of various pharmaceuticals, agrochemicals, and other fine chemicals. Its unique structure and reactivity make it an essential reagent in the development of diverse organic compounds. In particular, 4-Bromo-3-fluoro-N-methylbenzenesulfonamide is utilized for introducing specific functional groups or moieties into target molecules, thereby enabling the synthesis of complex organic structures with tailored properties. Its application in chemical synthesis plays a crucial role in the advancement of modern drug discovery, material science, and chemical research.
FEATURED PRODUCTS