logo
Home  > 7-Amino-2,2-dimethyl-2H-benzo[b][1,4]oxazin-3(4H)-one

AE09179

105807-83-8 | 7-Amino-2,2-dimethyl-2H-benzo[b][1,4]oxazin-3(4H)-one

Packsize Purity Availability Price Discounted Price    Quantity
250mg 98% in stock $19.00 $13.00 -   +
1g 98% in stock $39.00 $28.00 -   +
5g 98% in stock $186.00 $130.00 -   +
10g 98% in stock $362.00 $254.00 -   +
25g 98% in stock $532.00 $372.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AE09179
Chemical Name: 7-Amino-2,2-dimethyl-2H-benzo[b][1,4]oxazin-3(4H)-one
CAS Number: 105807-83-8
Molecular Formula: C10H12N2O2
Molecular Weight: 192.2145
MDL Number: MFCD11048439
SMILES: Nc1ccc2c(c1)OC(C(=O)N2)(C)C

 

Upstream Synthesis Route 
  • 7-Amino-2,2-dimethyl-2H-benzo[b][1,4]oxazin-3(4H)-one serves as a valuable building block in chemical synthesis due to its unique structural features and reactivity. This compound is commonly utilized as a nucleophilic reagent in the formation of various heterocyclic compounds through cyclization reactions. Its amino group can participate in a range of synthetic transformations, such as acylation, alkylation, and condensation reactions, leading to the creation of diverse chemical structures with potential biological activities. Additionally, the presence of the oxazin ring in its structure enhances its utility in the synthesis of pharmaceuticals and agrochemicals by providing a versatile platform for further modification and functionalization.
FEATURED PRODUCTS