AI06845
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 98% | in stock | $55.00 | $39.00 | - + | |
250mg | 98% | in stock | $105.00 | $74.00 | - + | |
5g | 98% | in stock | $1,317.00 | $922.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI06845 |
Chemical Name: | Ethyl 7-bromo-2-oxochromene-3-carboxylate |
CAS Number: | 105837-04-5 |
Molecular Formula: | C12H9BrO4 |
Molecular Weight: | 297.10146 |
MDL Number: | MFCD22373079 |
SMILES: | CCOC(=O)c1cc2ccc(cc2oc1=O)Br |
Complexity: | 364 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 4 |
Rotatable Bond Count: | 3 |
XLogP3: | 3 |
Ethyl 7-bromo-2-oxochromene-3-carboxylate is a versatile compound commonly employed in chemical synthesis for the production of various pharmaceuticals, agrochemicals, and organic compounds. Its unique structure and functional groups make it a valuable building block in organic chemistry.This compound can be utilized as a key intermediate in the synthesis of heterocyclic compounds, particularly in the development of potential drug candidates. Its presence of a bromo group and an oxochromene ring allows for diversification through various functional group transformations, enabling the synthesis of complex molecules with specific biological activities.In addition, Ethyl 7-bromo-2-oxochromene-3-carboxylate can be used for the preparation of novel materials in materials science applications. Its structural features provide opportunities for modifying its properties through chemical modifications, offering possibilities for creating materials with tailored characteristics for specific industrial uses.Overall, the application of Ethyl 7-bromo-2-oxochromene-3-carboxylate in chemical synthesis showcases its significance as a valuable precursor in the development of important compounds with diverse applications in pharmaceuticals, agrochemicals, and materials science.