logo
Home  > 5-Methoxy-1,2-dimethyl-1h-indole-3-carboxylic acid

AD79450

105909-93-1 | 5-Methoxy-1,2-dimethyl-1h-indole-3-carboxylic acid

Packsize Purity Availability Price Discounted Price    Quantity
1g 95% in stock $235.00 $164.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AD79450
Chemical Name: 5-Methoxy-1,2-dimethyl-1h-indole-3-carboxylic acid
CAS Number: 105909-93-1
Molecular Formula: C12H13NO3
Molecular Weight: 219.23652000000004
MDL Number: MFCD00458840
SMILES: COc1ccc2c(c1)c(C(=O)O)c(n2C)C

 

Upstream Synthesis Route 
  • The 5-Methoxy-1,2-dimethyl-1H-indole-3-carboxylic acid is a versatile compound that finds wide application in chemical synthesis processes. Due to its unique molecular structure, this compound serves as a key building block in the creation of various organic compounds and pharmaceutical intermediates. In chemical synthesis, 5-Methoxy-1,2-dimethyl-1H-indole-3-carboxylic acid acts as a crucial starting material for the synthesis of diverse indole-based molecules, which are important in medicinal chemistry and drug discovery. Its functional groups allow for efficient derivatization, making it a valuable tool for creating complex organic molecules with specific biological activities. This compound plays a significant role in the development of new drugs, agrochemicals, and materials, highlighting its importance in the field of chemical synthesis.
FEATURED PRODUCTS